C14H13N3O2 — CID 13266613
1,4-dimethoxy-5-methylpyridazino[4,5-c]quinoline (PubChem CID 13266613) has the molecular formula C14H13N3O2 and a molecular weight of 255.28 g/mol. Its IUPAC name is 1,4-dimethoxy-5-methylpyridazino[4,5-c]quinoline.
| Compound Name | 1,4-dimethoxy-5-methylpyridazino[4,5-c]quinoline |
|---|---|
| PubChem CID | 13266613 |
| Molecular Formula | C14H13N3O2 |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 1,4-dimethoxy-5-methylpyridazino[4,5-c]quinoline |
| SMILES | COc1nnc(OC)c2c1c(C)nc1ccccc12 |
| InChI | InChI=1S/C14H13N3O2/c1-8-11-12(9-6-4-5-7-10(9)15-8)14(19-3)17-16-13(11)18-2/h4-7H,1-3H3 |
| InChIKey | UUMQVBLGWCSDHQ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|