About cyclododecyl prop-2-enyl carbonate
cyclododecyl prop-2-enyl carbonate (PubChem CID 13272703) has the molecular formula C16H28O3
and a molecular weight of 268.40 g/mol. Its IUPAC name is cyclododecyl prop-2-enyl carbonate.
Molecular Properties
| Compound Name | cyclododecyl prop-2-enyl carbonate |
| PubChem CID | 13272703 |
| Molecular Formula | C16H28O3 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | cyclododecyl prop-2-enyl carbonate |
| SMILES | C=CCOC(=O)OC1CCCCCCCCCCC1 |
| InChI | InChI=1S/C16H28O3/c1-2-14-18-16(17)19-15-12-10-8-6-4-3-5-7-9-11-13-15/h2,15H,1,3-14H2 |
| InChIKey | RNGUNPMXQSJSEI-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze cyclododecyl prop-2-enyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclododecyl prop-2-enyl carbonate?
The IUPAC name of cyclododecyl prop-2-enyl carbonate (CID 13272703) is cyclododecyl prop-2-enyl carbonate.
What is the SMILES notation for cyclododecyl prop-2-enyl carbonate?
The canonical SMILES for cyclododecyl prop-2-enyl carbonate is C=CCOC(=O)OC1CCCCCCCCCCC1.
What is the InChIKey of cyclododecyl prop-2-enyl carbonate?
The InChIKey is RNGUNPMXQSJSEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28O3/c1-2-14-18-16(17)19-15-12-10-8-6-4-3-5-7-9-11-13-15/h2,15H,1,3-14H2.
What are the key properties of cyclododecyl prop-2-enyl carbonate?
cyclododecyl prop-2-enyl carbonate has a molecular weight of 268.40 g/mol, XLogP of 5.00, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclododecyl prop-2-enyl carbonate is sourced from PubChem (CID 13272703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).