About cyclohexyl prop-2-enyl carbonate
cyclohexyl prop-2-enyl carbonate (PubChem CID 14917718) has the molecular formula C10H16O3
and a molecular weight of 184.23 g/mol. Its IUPAC name is cyclohexyl prop-2-enyl carbonate.
Molecular Properties
| Compound Name | cyclohexyl prop-2-enyl carbonate |
| PubChem CID | 14917718 |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.23 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | cyclohexyl prop-2-enyl carbonate |
| SMILES | C=CCOC(=O)OC1CCCCC1 |
| InChI | InChI=1S/C10H16O3/c1-2-8-12-10(11)13-9-6-4-3-5-7-9/h2,9H,1,3-8H2 |
| InChIKey | FDNDILYEXVOGEO-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.23 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze cyclohexyl prop-2-enyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyl prop-2-enyl carbonate?
The IUPAC name of cyclohexyl prop-2-enyl carbonate (CID 14917718) is cyclohexyl prop-2-enyl carbonate.
What is the SMILES notation for cyclohexyl prop-2-enyl carbonate?
The canonical SMILES for cyclohexyl prop-2-enyl carbonate is C=CCOC(=O)OC1CCCCC1.
What is the InChIKey of cyclohexyl prop-2-enyl carbonate?
The InChIKey is FDNDILYEXVOGEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O3/c1-2-8-12-10(11)13-9-6-4-3-5-7-9/h2,9H,1,3-8H2.
What are the key properties of cyclohexyl prop-2-enyl carbonate?
cyclohexyl prop-2-enyl carbonate has a molecular weight of 184.23 g/mol, XLogP of 2.66, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyl prop-2-enyl carbonate is sourced from PubChem (CID 14917718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).