C21H17NO4 — CID 13273532
dimethyl 9-methyl-5-phenyl-11-azatricyclo[5.3.1.04,11]undeca-1(10),2,4,6,8-pentaene-2,3-dicarboxylate (PubChem CID 13273532) has the molecular formula C21H17NO4 and a molecular weight of 347.37 g/mol. Its IUPAC name is dimethyl 9-methyl-5-phenyl-11-azatricyclo[5.3.1.04,11]undeca-1(10),2,4,6,8-pentaene-2,3-dicarboxylate.
| Compound Name | dimethyl 9-methyl-5-phenyl-11-azatricyclo[5.3.1.04,11]undeca-1(10),2,4,6,8-pentaene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 13273532 |
| Molecular Formula | C21H17NO4 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | dimethyl 9-methyl-5-phenyl-11-azatricyclo[5.3.1.04,11]undeca-1(10),2,4,6,8-pentaene-2,3-dicarboxylate |
| SMILES | COC(=O)c1c(C(=O)OC)c2c(-c3ccccc3)cc3cc(C)cc1n32 |
| InChI | InChI=1S/C21H17NO4/c1-12-9-14-11-15(13-7-5-4-6-8-13)19-18(21(24)26-3)17(20(23)25-2)16(10-12)22(14)19/h4-11H,1-3H3 |
| InChIKey | WBOZTCBNJNFKDK-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |