C28H23NO6 — CID 18706950
dimethyl 8-(hydroxymethyl)-5-(4-phenylmethoxyphenyl)-11-azatricyclo[5.3.1.04,11]undeca-1,3,5,7,9-pentaene-2,3-dicarboxylate (PubChem CID 18706950) has the molecular formula C28H23NO6 and a molecular weight of 469.49 g/mol. Its IUPAC name is dimethyl 8-(hydroxymethyl)-5-(4-phenylmethoxyphenyl)-11-azatricyclo[5.3.1.04,11]undeca-1,3,5,7,9-pentaene-2,3-dicarboxylate.
| Compound Name | dimethyl 8-(hydroxymethyl)-5-(4-phenylmethoxyphenyl)-11-azatricyclo[5.3.1.04,11]undeca-1,3,5,7,9-pentaene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 18706950 |
| Molecular Formula | C28H23NO6 |
| Molecular Weight | 469.49 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | dimethyl 8-(hydroxymethyl)-5-(4-phenylmethoxyphenyl)-11-azatricyclo[5.3.1.04,11]undeca-1,3,5,7,9-pentaene-2,3-dicarboxylate |
| SMILES | COC(=O)c1c(C(=O)OC)c2c(-c3ccc(OCc4ccccc4)cc3)cc3c(CO)ccc1n32 |
| InChI | InChI=1S/C28H23NO6/c1-33-27(31)24-22-13-10-19(15-30)23-14-21(26(29(22)23)25(24)28(32)34-2)18-8-11-20(12-9-18)35-16-17-6-4-3-5-7-17/h3-14,30H,15-16H2,1-2H3 |
| InChIKey | YJBPCAQHADWUFZ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.49 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |