C34H27NO6 — CID 18706922
6-ethyl-10-phenylmethoxy-5-(4-phenylmethoxyphenyl)-11-azatricyclo[5.3.1.04,11]undeca-1(10),2,4,6,8-pentaene-2,3-dicarboxylic acid (PubChem CID 18706922) has the molecular formula C34H27NO6 and a molecular weight of 545.59 g/mol. Its IUPAC name is 6-ethyl-10-phenylmethoxy-5-(4-phenylmethoxyphenyl)-11-azatricyclo[5.3.1.04,11]undeca-1(10),2,4,6,8-pentaene-2,3-dicarboxylic acid.
| Compound Name | 6-ethyl-10-phenylmethoxy-5-(4-phenylmethoxyphenyl)-11-azatricyclo[5.3.1.04,11]undeca-1(10),2,4,6,8-pentaene-2,3-dicarboxylic acid |
|---|---|
| PubChem CID | 18706922 |
| Molecular Formula | C34H27NO6 |
| Molecular Weight | 545.59 g/mol |
| Exact Mass | 545.18 |
| IUPAC Name | 6-ethyl-10-phenylmethoxy-5-(4-phenylmethoxyphenyl)-11-azatricyclo[5.3.1.04,11]undeca-1(10),2,4,6,8-pentaene-2,3-dicarboxylic acid |
| SMILES | CCc1c(-c2ccc(OCc3ccccc3)cc2)c2c(C(=O)O)c(C(=O)O)c3c(OCc4ccccc4)ccc1n32 |
| InChI | InChI=1S/C34H27NO6/c1-2-25-26-17-18-27(41-20-22-11-7-4-8-12-22)31-29(33(36)37)30(34(38)39)32(35(26)31)28(25)23-13-15-24(16-14-23)40-19-21-9-5-3-6-10-21/h3-18H,2,19-20H2,1H3,(H,36,37)(H,38,39) |
| InChIKey | LZTBEXAJSHEPPW-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 97.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.59 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |