C32H33NO3 — CID 18706933
7-[6-ethyl-5-(4-phenylmethoxyphenyl)-11-azatricyclo[5.3.1.04,11]undeca-1,3,5,7,9-pentaen-2-yl]heptanoic acid (PubChem CID 18706933) has the molecular formula C32H33NO3 and a molecular weight of 479.62 g/mol. Its IUPAC name is 7-[6-ethyl-5-(4-phenylmethoxyphenyl)-11-azatricyclo[5.3.1.04,11]undeca-1,3,5,7,9-pentaen-2-yl]heptanoic acid.
| Compound Name | 7-[6-ethyl-5-(4-phenylmethoxyphenyl)-11-azatricyclo[5.3.1.04,11]undeca-1,3,5,7,9-pentaen-2-yl]heptanoic acid |
|---|---|
| PubChem CID | 18706933 |
| Molecular Formula | C32H33NO3 |
| Molecular Weight | 479.62 g/mol |
| Exact Mass | 479.25 |
| IUPAC Name | 7-[6-ethyl-5-(4-phenylmethoxyphenyl)-11-azatricyclo[5.3.1.04,11]undeca-1,3,5,7,9-pentaen-2-yl]heptanoic acid |
| SMILES | CCc1c(-c2ccc(OCc3ccccc3)cc2)c2cc(CCCCCCC(=O)O)c3cccc1n32 |
| InChI | InChI=1S/C32H33NO3/c1-2-27-29-15-10-14-28-25(13-8-3-4-9-16-31(34)35)21-30(33(28)29)32(27)24-17-19-26(20-18-24)36-22-23-11-6-5-7-12-23/h5-7,10-12,14-15,17-21H,2-4,8-9,13,16,22H2,1H3,(H,34,35) |
| InChIKey | IWFNXNCHRSVQDT-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.62 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|