C28H23NO6 — CID 18706977
6-ethyl-8-(hydroxymethyl)-5-(4-phenylmethoxyphenyl)-11-azatricyclo[5.3.1.04,11]undeca-1,3,5,7,9-pentaene-2,3-dicarboxylic acid (PubChem CID 18706977) has the molecular formula C28H23NO6 and a molecular weight of 469.49 g/mol. Its IUPAC name is 6-ethyl-8-(hydroxymethyl)-5-(4-phenylmethoxyphenyl)-11-azatricyclo[5.3.1.04,11]undeca-1,3,5,7,9-pentaene-2,3-dicarboxylic acid.
| Compound Name | 6-ethyl-8-(hydroxymethyl)-5-(4-phenylmethoxyphenyl)-11-azatricyclo[5.3.1.04,11]undeca-1,3,5,7,9-pentaene-2,3-dicarboxylic acid |
|---|---|
| PubChem CID | 18706977 |
| Molecular Formula | C28H23NO6 |
| Molecular Weight | 469.49 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | 6-ethyl-8-(hydroxymethyl)-5-(4-phenylmethoxyphenyl)-11-azatricyclo[5.3.1.04,11]undeca-1,3,5,7,9-pentaene-2,3-dicarboxylic acid |
| SMILES | CCc1c(-c2ccc(OCc3ccccc3)cc2)c2c(C(=O)O)c(C(=O)O)c3ccc(CO)c1n32 |
| InChI | InChI=1S/C28H23NO6/c1-2-20-22(17-8-11-19(12-9-17)35-15-16-6-4-3-5-7-16)26-24(28(33)34)23(27(31)32)21-13-10-18(14-30)25(20)29(21)26/h3-13,30H,2,14-15H2,1H3,(H,31,32)(H,33,34) |
| InChIKey | DWGKBBWICUHZCF-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.49 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |