C26H19NO4 — CID 13186335
dimethyl 3-phenylpyrrolo[1,2-f]phenanthridine-1,2-dicarboxylate (PubChem CID 13186335) has the molecular formula C26H19NO4 and a molecular weight of 409.44 g/mol. Its IUPAC name is dimethyl 3-phenylpyrrolo[1,2-f]phenanthridine-1,2-dicarboxylate.
| Compound Name | dimethyl 3-phenylpyrrolo[1,2-f]phenanthridine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 13186335 |
| Molecular Formula | C26H19NO4 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | dimethyl 3-phenylpyrrolo[1,2-f]phenanthridine-1,2-dicarboxylate |
| SMILES | COC(=O)c1c(C(=O)OC)c2c3ccccc3c3ccccc3n2c1-c1ccccc1 |
| InChI | InChI=1S/C26H19NO4/c1-30-25(28)21-22(26(29)31-2)24-19-14-7-6-12-17(19)18-13-8-9-15-20(18)27(24)23(21)16-10-4-3-5-11-16/h3-15H,1-2H3 |
| InChIKey | IKMVKBUEYYLQDB-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|