C24H19NO7 — CID 72945857
dimethyl 1-(2-ethoxy-2-oxoacetyl)pyrrolo[1,2-f]phenanthridine-2,3-dicarboxylate (PubChem CID 72945857) has the molecular formula C24H19NO7 and a molecular weight of 433.42 g/mol. Its IUPAC name is dimethyl 1-(2-ethoxy-2-oxoacetyl)pyrrolo[1,2-f]phenanthridine-2,3-dicarboxylate.
| Compound Name | dimethyl 1-(2-ethoxy-2-oxoacetyl)pyrrolo[1,2-f]phenanthridine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 72945857 |
| Molecular Formula | C24H19NO7 |
| Molecular Weight | 433.42 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | dimethyl 1-(2-ethoxy-2-oxoacetyl)pyrrolo[1,2-f]phenanthridine-2,3-dicarboxylate |
| SMILES | CCOC(=O)C(=O)c1c(C(=O)OC)c(C(=O)OC)n2c3ccccc3c3ccccc3c12 |
| InChI | InChI=1S/C24H19NO7/c1-4-32-24(29)21(26)17-18(22(27)30-2)20(23(28)31-3)25-16-12-8-7-10-14(16)13-9-5-6-11-15(13)19(17)25/h5-12H,4H2,1-3H3 |
| InChIKey | QEBWSKVPMJODMI-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 100.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.42 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|