C32H40ClN3O6S — CID 132755297
N-butyl-2-[[2-(N-(4-chlorophenyl)sulfonyl-2-ethoxyanilino)acetyl]-[(3-methoxyphenyl)methyl]amino]butanamide (PubChem CID 132755297) has the molecular formula C32H40ClN3O6S and a molecular weight of 630.21 g/mol. Its IUPAC name is N-butyl-2-[[2-(N-(4-chlorophenyl)sulfonyl-2-ethoxyanilino)acetyl]-[(3-methoxyphenyl)methyl]amino]butanamide.
| Compound Name | N-butyl-2-[[2-(N-(4-chlorophenyl)sulfonyl-2-ethoxyanilino)acetyl]-[(3-methoxyphenyl)methyl]amino]butanamide |
|---|---|
| PubChem CID | 132755297 |
| Molecular Formula | C32H40ClN3O6S |
| Molecular Weight | 630.21 g/mol |
| Exact Mass | 629.23 |
| IUPAC Name | N-butyl-2-[[2-(N-(4-chlorophenyl)sulfonyl-2-ethoxyanilino)acetyl]-[(3-methoxyphenyl)methyl]amino]butanamide |
| SMILES | CCCCNC(=O)C(CC)N(Cc1cccc(OC)c1)C(=O)CN(c1ccccc1OCC)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C32H40ClN3O6S/c1-5-8-20-34-32(38)28(6-2)35(22-24-12-11-13-26(21-24)41-4)31(37)23-36(29-14-9-10-15-30(29)42-7-3)43(39,40)27-18-16-25(33)17-19-27/h9-19,21,28H,5-8,20,22-23H2,1-4H3,(H,34,38) |
| InChIKey | MXVHIWHGPAKVAA-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.21 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|