C11H12BrNO2S — CID 13275563
ethyl 4-(2-bromoethyl)-6H-thieno[2,3-b]pyrrole-5-carboxylate (PubChem CID 13275563) has the molecular formula C11H12BrNO2S and a molecular weight of 302.19 g/mol. Its IUPAC name is ethyl 4-(2-bromoethyl)-6H-thieno[2,3-b]pyrrole-5-carboxylate.
| Compound Name | ethyl 4-(2-bromoethyl)-6H-thieno[2,3-b]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 13275563 |
| Molecular Formula | C11H12BrNO2S |
| Molecular Weight | 302.19 g/mol |
| Exact Mass | 300.98 |
| IUPAC Name | ethyl 4-(2-bromoethyl)-6H-thieno[2,3-b]pyrrole-5-carboxylate |
| SMILES | CCOC(=O)c1[nH]c2sccc2c1CCBr |
| InChI | InChI=1S/C11H12BrNO2S/c1-2-15-11(14)9-7(3-5-12)8-4-6-16-10(8)13-9/h4,6,13H,2-3,5H2,1H3 |
| InChIKey | QTNHKXIQPRJDSS-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.19 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|