C10H11BrN2O2S — CID 175914939
ethyl 2-(2-bromoethyl)-4H-pyrrolo[3,2-d][1,3]thiazole-5-carboxylate (PubChem CID 175914939) has the molecular formula C10H11BrN2O2S and a molecular weight of 303.18 g/mol. Its IUPAC name is ethyl 2-(2-bromoethyl)-4H-pyrrolo[3,2-d][1,3]thiazole-5-carboxylate.
| Compound Name | ethyl 2-(2-bromoethyl)-4H-pyrrolo[3,2-d][1,3]thiazole-5-carboxylate |
|---|---|
| PubChem CID | 175914939 |
| Molecular Formula | C10H11BrN2O2S |
| Molecular Weight | 303.18 g/mol |
| Exact Mass | 301.97 |
| IUPAC Name | ethyl 2-(2-bromoethyl)-4H-pyrrolo[3,2-d][1,3]thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1cc2nc(CCBr)sc2[nH]1 |
| InChI | InChI=1S/C10H11BrN2O2S/c1-2-15-10(14)7-5-6-9(13-7)16-8(12-6)3-4-11/h5,13H,2-4H2,1H3 |
| InChIKey | WRHGQKFWKFGWBI-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.18 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|