C10H11N3O2 — CID 123135469
ethyl 6-amino-1H-pyrrolo[3,2-b]pyridine-2-carboxylate (PubChem CID 123135469) has the molecular formula C10H11N3O2 and a molecular weight of 205.22 g/mol. Its IUPAC name is ethyl 6-amino-1H-pyrrolo[3,2-b]pyridine-2-carboxylate.
| Compound Name | ethyl 6-amino-1H-pyrrolo[3,2-b]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 123135469 |
| Molecular Formula | C10H11N3O2 |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | ethyl 6-amino-1H-pyrrolo[3,2-b]pyridine-2-carboxylate |
| SMILES | CCOC(=O)c1cc2ncc(N)cc2[nH]1 |
| InChI | InChI=1S/C10H11N3O2/c1-2-15-10(14)9-4-7-8(13-9)3-6(11)5-12-7/h3-5,13H,2,11H2,1H3 |
| InChIKey | JMLQYRIUXWWSOG-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |