C31H34Cl2F3N3O4S — CID 132758819
N-butyl-2-[(2,4-dichlorophenyl)methyl-[2-[N-(4-methylphenyl)sulfonyl-3-(trifluoromethyl)anilino]acetyl]amino]butanamide (PubChem CID 132758819) has the molecular formula C31H34Cl2F3N3O4S and a molecular weight of 672.60 g/mol. Its IUPAC name is N-butyl-2-[(2,4-dichlorophenyl)methyl-[2-[N-(4-methylphenyl)sulfonyl-3-(trifluoromethyl)anilino]acetyl]amino]butanamide.
| Compound Name | N-butyl-2-[(2,4-dichlorophenyl)methyl-[2-[N-(4-methylphenyl)sulfonyl-3-(trifluoromethyl)anilino]acetyl]amino]butanamide |
|---|---|
| PubChem CID | 132758819 |
| Molecular Formula | C31H34Cl2F3N3O4S |
| Molecular Weight | 672.60 g/mol |
| Exact Mass | 671.16 |
| IUPAC Name | N-butyl-2-[(2,4-dichlorophenyl)methyl-[2-[N-(4-methylphenyl)sulfonyl-3-(trifluoromethyl)anilino]acetyl]amino]butanamide |
| SMILES | CCCCNC(=O)C(CC)N(Cc1ccc(Cl)cc1Cl)C(=O)CN(c1cccc(C(F)(F)F)c1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C31H34Cl2F3N3O4S/c1-4-6-16-37-30(41)28(5-2)38(19-22-12-13-24(32)18-27(22)33)29(40)20-39(25-9-7-8-23(17-25)31(34,35)36)44(42,43)26-14-10-21(3)11-15-26/h7-15,17-18,28H,4-6,16,19-20H2,1-3H3,(H,37,41) |
| InChIKey | RSUYAUMTRZCQKS-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.60 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|