C18H24FN3O2 — CID 132764280
3-[(4-fluorophenoxy)methyl]-3-methoxy-1-[(5-methyl-1H-imidazol-4-yl)methyl]piperidine (PubChem CID 132764280) has the molecular formula C18H24FN3O2 and a molecular weight of 333.41 g/mol. Its IUPAC name is 3-[(4-fluorophenoxy)methyl]-3-methoxy-1-[(5-methyl-1H-imidazol-4-yl)methyl]piperidine.
| Compound Name | 3-[(4-fluorophenoxy)methyl]-3-methoxy-1-[(5-methyl-1H-imidazol-4-yl)methyl]piperidine |
|---|---|
| PubChem CID | 132764280 |
| Molecular Formula | C18H24FN3O2 |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | 3-[(4-fluorophenoxy)methyl]-3-methoxy-1-[(5-methyl-1H-imidazol-4-yl)methyl]piperidine |
| SMILES | COC1(COc2ccc(F)cc2)CCCN(Cc2nc[nH]c2C)C1 |
| InChI | InChI=1S/C18H24FN3O2/c1-14-17(21-13-20-14)10-22-9-3-8-18(11-22,23-2)12-24-16-6-4-15(19)5-7-16/h4-7,13H,3,8-12H2,1-2H3,(H,20,21) |
| InChIKey | ASEYVYISYNDGPL-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 50.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |