C15H13BrO6 — CID 132765427
(4-acetyloxy-6-bromo-7-methyl-5,8-dioxo-1,8a-dihydronaphthalen-1-yl) acetate (PubChem CID 132765427) has the molecular formula C15H13BrO6 and a molecular weight of 369.17 g/mol. Its IUPAC name is (4-acetyloxy-6-bromo-7-methyl-5,8-dioxo-1,8a-dihydronaphthalen-1-yl) acetate.
| Compound Name | (4-acetyloxy-6-bromo-7-methyl-5,8-dioxo-1,8a-dihydronaphthalen-1-yl) acetate |
|---|---|
| PubChem CID | 132765427 |
| Molecular Formula | C15H13BrO6 |
| Molecular Weight | 369.17 g/mol |
| Exact Mass | 367.99 |
| IUPAC Name | (4-acetyloxy-6-bromo-7-methyl-5,8-dioxo-1,8a-dihydronaphthalen-1-yl) acetate |
| SMILES | CC(=O)OC1=C2C(=O)C(Br)=C(C)C(=O)C2C(OC(C)=O)C=C1 |
| InChI | InChI=1S/C15H13BrO6/c1-6-13(16)15(20)12-10(22-8(3)18)5-4-9(21-7(2)17)11(12)14(6)19/h4-5,9,11H,1-3H3 |
| InChIKey | WFEZHMNDNYHDIO-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.17 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|