(3,7-dimethoxy-4-methylcyclohepta-1,3,5-trien-1-yl) acetate

C12H16O4 — CID 142859283

IUPAC(3,7-dimethoxy-4-methylcyclohepta-1,3,5-trien-1-yl) acetate
SMILESCOC1=C(C)C=CC(OC)C(OC(C)=O)=C1
InChIInChI=1S/C12H16O4/c1-8-5-6-10(14-3)12(16-9(2)13)7-11(8)15-4/h5-7,10H,1-4H3
InChIKeyINEANCKWKFEJOP-UHFFFAOYSA-N
MW224.26 g/mol
LogP1.94
Rot. Bonds3

About (3,7-dimethoxy-4-methylcyclohepta-1,3,5-trien-1-yl) acetate

(3,7-dimethoxy-4-methylcyclohepta-1,3,5-trien-1-yl) acetate (PubChem CID 142859283) has the molecular formula C12H16O4 and a molecular weight of 224.26 g/mol. Its IUPAC name is (3,7-dimethoxy-4-methylcyclohepta-1,3,5-trien-1-yl) acetate.

Molecular Properties

Compound Name(3,7-dimethoxy-4-methylcyclohepta-1,3,5-trien-1-yl) acetate
PubChem CID142859283
Molecular FormulaC12H16O4
Molecular Weight224.26 g/mol
Exact Mass224.10
IUPAC Name(3,7-dimethoxy-4-methylcyclohepta-1,3,5-trien-1-yl) acetate
SMILESCOC1=C(C)C=CC(OC)C(OC(C)=O)=C1
InChIInChI=1S/C12H16O4/c1-8-5-6-10(14-3)12(16-9(2)13)7-11(8)15-4/h5-7,10H,1-4H3
InChIKeyINEANCKWKFEJOP-UHFFFAOYSA-N
XLogP1.94
TPSA44.76 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500224.26
LogP ≤ 51.94
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze (3,7-dimethoxy-4-methylcyclohepta-1,3,5-trien-1-yl) acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3,7-dimethoxy-4-methylcyclohepta-1,3,5-trien-1-yl) acetate?
The IUPAC name of (3,7-dimethoxy-4-methylcyclohepta-1,3,5-trien-1-yl) acetate (CID 142859283) is (3,7-dimethoxy-4-methylcyclohepta-1,3,5-trien-1-yl) acetate.
What is the SMILES notation for (3,7-dimethoxy-4-methylcyclohepta-1,3,5-trien-1-yl) acetate?
The canonical SMILES for (3,7-dimethoxy-4-methylcyclohepta-1,3,5-trien-1-yl) acetate is COC1=C(C)C=CC(OC)C(OC(C)=O)=C1.
What is the InChIKey of (3,7-dimethoxy-4-methylcyclohepta-1,3,5-trien-1-yl) acetate?
The InChIKey is INEANCKWKFEJOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O4/c1-8-5-6-10(14-3)12(16-9(2)13)7-11(8)15-4/h5-7,10H,1-4H3.
What are the key properties of (3,7-dimethoxy-4-methylcyclohepta-1,3,5-trien-1-yl) acetate?
(3,7-dimethoxy-4-methylcyclohepta-1,3,5-trien-1-yl) acetate has a molecular weight of 224.26 g/mol, XLogP of 1.94, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3,7-dimethoxy-4-methylcyclohepta-1,3,5-trien-1-yl) acetate is sourced from PubChem (CID 142859283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).