C15H10Br4O5S — CID 59745424
[2,6-dibromo-4-(3,5-dibromo-4-methoxyphenyl)sulfonylphenyl] acetate (PubChem CID 59745424) has the molecular formula C15H10Br4O5S and a molecular weight of 621.92 g/mol. Its IUPAC name is [2,6-dibromo-4-(3,5-dibromo-4-methoxyphenyl)sulfonylphenyl] acetate.
| Compound Name | [2,6-dibromo-4-(3,5-dibromo-4-methoxyphenyl)sulfonylphenyl] acetate |
|---|---|
| PubChem CID | 59745424 |
| Molecular Formula | C15H10Br4O5S |
| Molecular Weight | 621.92 g/mol |
| Exact Mass | 617.70 |
| IUPAC Name | [2,6-dibromo-4-(3,5-dibromo-4-methoxyphenyl)sulfonylphenyl] acetate |
| SMILES | COc1c(Br)cc(S(=O)(=O)c2cc(Br)c(OC(C)=O)c(Br)c2)cc1Br |
| InChI | InChI=1S/C15H10Br4O5S/c1-7(20)24-15-12(18)5-9(6-13(15)19)25(21,22)8-3-10(16)14(23-2)11(17)4-8/h3-6H,1-2H3 |
| InChIKey | DDUCYHMMZCVHGN-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.92 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|