C10H6N2OSSe — CID 13277183
2-(1,3-thiazol-2-yl)-1,2-benzoselenazol-3-one (PubChem CID 13277183) has the molecular formula C10H6N2OSSe and a molecular weight of 281.20 g/mol. Its IUPAC name is 2-(1,3-thiazol-2-yl)-1,2-benzoselenazol-3-one.
| Compound Name | 2-(1,3-thiazol-2-yl)-1,2-benzoselenazol-3-one |
|---|---|
| PubChem CID | 13277183 |
| Molecular Formula | C10H6N2OSSe |
| Molecular Weight | 281.20 g/mol |
| Exact Mass | 281.94 |
| IUPAC Name | 2-(1,3-thiazol-2-yl)-1,2-benzoselenazol-3-one |
| SMILES | O=c1c2ccccc2[se]n1-c1nccs1 |
| InChI | InChI=1S/C10H6N2OSSe/c13-9-7-3-1-2-4-8(7)15-12(9)10-11-5-6-14-10/h1-6H |
| InChIKey | UJOWPGFRUZFDTE-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.20 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|