C25H32N4O4S — CID 132773685
2-(4-acetyl-3-phenylpiperazin-1-yl)-N-(4-piperidin-1-ylsulfonylphenyl)acetamide (PubChem CID 132773685) has the molecular formula C25H32N4O4S and a molecular weight of 484.62 g/mol. Its IUPAC name is 2-(4-acetyl-3-phenylpiperazin-1-yl)-N-(4-piperidin-1-ylsulfonylphenyl)acetamide.
| Compound Name | 2-(4-acetyl-3-phenylpiperazin-1-yl)-N-(4-piperidin-1-ylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 132773685 |
| Molecular Formula | C25H32N4O4S |
| Molecular Weight | 484.62 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | 2-(4-acetyl-3-phenylpiperazin-1-yl)-N-(4-piperidin-1-ylsulfonylphenyl)acetamide |
| SMILES | CC(=O)N1CCN(CC(=O)Nc2ccc(S(=O)(=O)N3CCCCC3)cc2)CC1c1ccccc1 |
| InChI | InChI=1S/C25H32N4O4S/c1-20(30)29-17-16-27(18-24(29)21-8-4-2-5-9-21)19-25(31)26-22-10-12-23(13-11-22)34(32,33)28-14-6-3-7-15-28/h2,4-5,8-13,24H,3,6-7,14-19H2,1H3,(H,26,31) |
| InChIKey | SWGYGXBDULZRKX-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.62 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |