About 5-ethyl-4,6,7,8-tetrahydrothieno[3,2-c]azepin-2-amine
5-ethyl-4,6,7,8-tetrahydrothieno[3,2-c]azepin-2-amine (PubChem CID 13277390) has the molecular formula C10H16N2S
and a molecular weight of 196.32 g/mol. Its IUPAC name is 5-ethyl-4,6,7,8-tetrahydrothieno[3,2-c]azepin-2-amine.
Analyze 5-ethyl-4,6,7,8-tetrahydrothieno[3,2-c]azepin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-4,6,7,8-tetrahydrothieno[3,2-c]azepin-2-amine?
The IUPAC name of 5-ethyl-4,6,7,8-tetrahydrothieno[3,2-c]azepin-2-amine (CID 13277390) is 5-ethyl-4,6,7,8-tetrahydrothieno[3,2-c]azepin-2-amine.
What is the SMILES notation for 5-ethyl-4,6,7,8-tetrahydrothieno[3,2-c]azepin-2-amine?
The canonical SMILES for 5-ethyl-4,6,7,8-tetrahydrothieno[3,2-c]azepin-2-amine is CCN1CCCc2sc(N)cc2C1.
What is the InChIKey of 5-ethyl-4,6,7,8-tetrahydrothieno[3,2-c]azepin-2-amine?
The InChIKey is NAPDQICAOHOPNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2S/c1-2-12-5-3-4-9-8(7-12)6-10(11)13-9/h6H,2-5,7,11H2,1H3.
What are the key properties of 5-ethyl-4,6,7,8-tetrahydrothieno[3,2-c]azepin-2-amine?
5-ethyl-4,6,7,8-tetrahydrothieno[3,2-c]azepin-2-amine has a molecular weight of 196.32 g/mol, XLogP of 2.10, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-4,6,7,8-tetrahydrothieno[3,2-c]azepin-2-amine is sourced from PubChem (CID 13277390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).