C26H33ClN2O2 — CID 13280849
[4-[3-(butylamino)propoxy]phenyl]-(2-butyl-1-chloroindolizin-3-yl)methanone (PubChem CID 13280849) has the molecular formula C26H33ClN2O2 and a molecular weight of 441.02 g/mol. Its IUPAC name is [4-[3-(butylamino)propoxy]phenyl]-(2-butyl-1-chloroindolizin-3-yl)methanone.
| Compound Name | [4-[3-(butylamino)propoxy]phenyl]-(2-butyl-1-chloroindolizin-3-yl)methanone |
|---|---|
| PubChem CID | 13280849 |
| Molecular Formula | C26H33ClN2O2 |
| Molecular Weight | 441.02 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | [4-[3-(butylamino)propoxy]phenyl]-(2-butyl-1-chloroindolizin-3-yl)methanone |
| SMILES | CCCCNCCCOc1ccc(C(=O)c2c(CCCC)c(Cl)c3ccccn23)cc1 |
| InChI | InChI=1S/C26H33ClN2O2/c1-3-5-10-22-24(27)23-11-7-8-18-29(23)25(22)26(30)20-12-14-21(15-13-20)31-19-9-17-28-16-6-4-2/h7-8,11-15,18,28H,3-6,9-10,16-17,19H2,1-2H3 |
| InChIKey | HONUWKTZINTNHC-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.02 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|