C24H21N3O4S — CID 132817469
N-(5-methyl-1,2-oxazol-3-yl)-4-[(4-phenylmethoxyphenyl)methylideneamino]benzenesulfonamide (PubChem CID 132817469) has the molecular formula C24H21N3O4S and a molecular weight of 447.52 g/mol. Its IUPAC name is N-(5-methyl-1,2-oxazol-3-yl)-4-[(4-phenylmethoxyphenyl)methylideneamino]benzenesulfonamide.
| Compound Name | N-(5-methyl-1,2-oxazol-3-yl)-4-[(4-phenylmethoxyphenyl)methylideneamino]benzenesulfonamide |
|---|---|
| PubChem CID | 132817469 |
| Molecular Formula | C24H21N3O4S |
| Molecular Weight | 447.52 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | N-(5-methyl-1,2-oxazol-3-yl)-4-[(4-phenylmethoxyphenyl)methylideneamino]benzenesulfonamide |
| SMILES | Cc1cc(NS(=O)(=O)c2ccc(/N=C/c3ccc(OCc4ccccc4)cc3)cc2)no1 |
| InChI | InChI=1S/C24H21N3O4S/c1-18-15-24(26-31-18)27-32(28,29)23-13-9-21(10-14-23)25-16-19-7-11-22(12-8-19)30-17-20-5-3-2-4-6-20/h2-16H,17H2,1H3,(H,26,27)/b25-16+ |
| InChIKey | MABAKQCAUVRKBY-PCLIKHOPSA-N |
| XLogP | 5.11 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.52 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|