C22H24N3O3S+ — CID 5103019
4-[[4-(2-methylpropoxy)phenyl]methylideneamino]-N-pyridin-1-ium-2-ylbenzenesulfonamide (PubChem CID 5103019) has the molecular formula C22H24N3O3S+ and a molecular weight of 410.52 g/mol. Its IUPAC name is 4-[[4-(2-methylpropoxy)phenyl]methylideneamino]-N-pyridin-1-ium-2-ylbenzenesulfonamide.
| Compound Name | 4-[[4-(2-methylpropoxy)phenyl]methylideneamino]-N-pyridin-1-ium-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 5103019 |
| Molecular Formula | C22H24N3O3S+ |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | 4-[[4-(2-methylpropoxy)phenyl]methylideneamino]-N-pyridin-1-ium-2-ylbenzenesulfonamide |
| SMILES | CC(C)COc1ccc(/C=N/c2ccc(S(=O)(=O)Nc3cccc[nH+]3)cc2)cc1 |
| InChI | InChI=1S/C22H23N3O3S/c1-17(2)16-28-20-10-6-18(7-11-20)15-24-19-8-12-21(13-9-19)29(26,27)25-22-5-3-4-14-23-22/h3-15,17H,16H2,1-2H3,(H,23,25)/p+1/b24-15+ |
| InChIKey | HHWAJEIOHLQOCA-BUVRLJJBSA-O |
| XLogP | 4.09 |
| TPSA | 81.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|