C27H25N3O4S — CID 21212200
4-[(4-ethoxy-3-phenylmethoxyphenyl)methylideneamino]-N-pyridin-2-ylbenzenesulfonamide (PubChem CID 21212200) has the molecular formula C27H25N3O4S and a molecular weight of 487.58 g/mol. Its IUPAC name is 4-[(4-ethoxy-3-phenylmethoxyphenyl)methylideneamino]-N-pyridin-2-ylbenzenesulfonamide.
| Compound Name | 4-[(4-ethoxy-3-phenylmethoxyphenyl)methylideneamino]-N-pyridin-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 21212200 |
| Molecular Formula | C27H25N3O4S |
| Molecular Weight | 487.58 g/mol |
| Exact Mass | 487.16 |
| IUPAC Name | 4-[(4-ethoxy-3-phenylmethoxyphenyl)methylideneamino]-N-pyridin-2-ylbenzenesulfonamide |
| SMILES | CCOc1ccc(/C=N/c2ccc(S(=O)(=O)Nc3ccccn3)cc2)cc1OCc1ccccc1 |
| InChI | InChI=1S/C27H25N3O4S/c1-2-33-25-16-11-22(18-26(25)34-20-21-8-4-3-5-9-21)19-29-23-12-14-24(15-13-23)35(31,32)30-27-10-6-7-17-28-27/h3-19H,2,20H2,1H3,(H,28,30)/b29-19+ |
| InChIKey | VBJPNVJDJFZOKF-VUTHCHCSSA-N |
| XLogP | 5.61 |
| TPSA | 89.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.58 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|