C17H21NO — CID 132821455
1-[(4Z)-5-phenylhepta-1,4-dien-4-yl]pyrrolidin-2-one (PubChem CID 132821455) has the molecular formula C17H21NO and a molecular weight of 255.36 g/mol. Its IUPAC name is 1-[(4Z)-5-phenylhepta-1,4-dien-4-yl]pyrrolidin-2-one.
| Compound Name | 1-[(4Z)-5-phenylhepta-1,4-dien-4-yl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 132821455 |
| Molecular Formula | C17H21NO |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | 1-[(4Z)-5-phenylhepta-1,4-dien-4-yl]pyrrolidin-2-one |
| SMILES | C=CC/C(=C(\CC)c1ccccc1)N1CCCC1=O |
| InChI | InChI=1S/C17H21NO/c1-3-9-16(18-13-8-12-17(18)19)15(4-2)14-10-6-5-7-11-14/h3,5-7,10-11H,1,4,8-9,12-13H2,2H3/b16-15- |
| InChIKey | ZETNSYRMECGHSA-NXVVXOECSA-N |
| XLogP | 4.01 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|