C64H60F6N2 — CID 132839412
1,4-bis(3,5-ditert-butylphenyl)-2,5-bis[2-[2-[4-(trifluoromethyl)phenyl]ethynyl]phenyl]pyrrolo[3,2-b]pyrrole (PubChem CID 132839412) has the molecular formula C64H60F6N2 and a molecular weight of 971.19 g/mol. Its IUPAC name is 1,4-bis(3,5-ditert-butylphenyl)-2,5-bis[2-[2-[4-(trifluoromethyl)phenyl]ethynyl]phenyl]pyrrolo[3,2-b]pyrrole.
| Compound Name | 1,4-bis(3,5-ditert-butylphenyl)-2,5-bis[2-[2-[4-(trifluoromethyl)phenyl]ethynyl]phenyl]pyrrolo[3,2-b]pyrrole |
|---|---|
| PubChem CID | 132839412 |
| Molecular Formula | C64H60F6N2 |
| Molecular Weight | 971.19 g/mol |
| Exact Mass | 970.47 |
| IUPAC Name | 1,4-bis(3,5-ditert-butylphenyl)-2,5-bis[2-[2-[4-(trifluoromethyl)phenyl]ethynyl]phenyl]pyrrolo[3,2-b]pyrrole |
| SMILES | CC(C)(C)c1cc(-n2c(-c3ccccc3C#Cc3ccc(C(F)(F)F)cc3)cc3c2cc(-c2ccccc2C#Cc2ccc(C(F)(F)F)cc2)n3-c2cc(C(C)(C)C)cc(C(C)(C)C)c2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C64H60F6N2/c1-59(2,3)47-33-48(60(4,5)6)36-51(35-47)71-55(53-19-15-13-17-43(53)27-21-41-23-29-45(30-24-41)63(65,66)67)39-58-57(71)40-56(72(58)52-37-49(61(7,8)9)34-50(38-52)62(10,11)12)54-20-16-14-18-44(54)28-22-42-25-31-46(32-26-42)64(68,69)70/h13-20,23-26,29-40H,1-12H3 |
| InChIKey | NIOJNGTUUQJYEL-UHFFFAOYSA-N |
| XLogP | 17.78 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 971.19 |
| LogP ≤ 5 | 17.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|