C29H19ClN4O4 — CID 132849632
6-amino-4-(4-chlorophenyl)-3-(7-methoxy-2-oxochromen-3-yl)-1-phenyl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile (PubChem CID 132849632) has the molecular formula C29H19ClN4O4 and a molecular weight of 522.95 g/mol. Its IUPAC name is 6-amino-4-(4-chlorophenyl)-3-(7-methoxy-2-oxochromen-3-yl)-1-phenyl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile.
| Compound Name | 6-amino-4-(4-chlorophenyl)-3-(7-methoxy-2-oxochromen-3-yl)-1-phenyl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile |
|---|---|
| PubChem CID | 132849632 |
| Molecular Formula | C29H19ClN4O4 |
| Molecular Weight | 522.95 g/mol |
| Exact Mass | 522.11 |
| IUPAC Name | 6-amino-4-(4-chlorophenyl)-3-(7-methoxy-2-oxochromen-3-yl)-1-phenyl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile |
| SMILES | COc1ccc2cc(-c3nn(-c4ccccc4)c4c3C(c3ccc(Cl)cc3)C(C#N)=C(N)O4)c(=O)oc2c1 |
| InChI | InChI=1S/C29H19ClN4O4/c1-36-20-12-9-17-13-21(29(35)37-23(17)14-20)26-25-24(16-7-10-18(30)11-8-16)22(15-31)27(32)38-28(25)34(33-26)19-5-3-2-4-6-19/h2-14,24H,32H2,1H3 |
| InChIKey | BNUDEGQEWIEZKV-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 116.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.95 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dhp_amino_CN_B(9)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|