C24H18N4O4 — CID 4775944
6-amino-3-(furan-2-yl)-4-(4-hydroxy-3-methoxyphenyl)-1-phenyl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile (PubChem CID 4775944) has the molecular formula C24H18N4O4 and a molecular weight of 426.43 g/mol. Its IUPAC name is 6-amino-3-(furan-2-yl)-4-(4-hydroxy-3-methoxyphenyl)-1-phenyl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile.
| Compound Name | 6-amino-3-(furan-2-yl)-4-(4-hydroxy-3-methoxyphenyl)-1-phenyl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile |
|---|---|
| PubChem CID | 4775944 |
| Molecular Formula | C24H18N4O4 |
| Molecular Weight | 426.43 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | 6-amino-3-(furan-2-yl)-4-(4-hydroxy-3-methoxyphenyl)-1-phenyl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile |
| SMILES | COc1cc(C2C(C#N)=C(N)Oc3c2c(-c2ccco2)nn3-c2ccccc2)ccc1O |
| InChI | InChI=1S/C24H18N4O4/c1-30-19-12-14(9-10-17(19)29)20-16(13-25)23(26)32-24-21(20)22(18-8-5-11-31-18)27-28(24)15-6-3-2-4-7-15/h2-12,20,29H,26H2,1H3 |
| InChIKey | QOGATCJNYUQPRL-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 119.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.43 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dhp_amino_CN_B(9)', 'substructure': 'N/A'} |
|---|