C23H15FN4O2 — CID 19334650
6-amino-4-(3-fluorophenyl)-3-(furan-2-yl)-1-phenyl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile (PubChem CID 19334650) has the molecular formula C23H15FN4O2 and a molecular weight of 398.40 g/mol. Its IUPAC name is 6-amino-4-(3-fluorophenyl)-3-(furan-2-yl)-1-phenyl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile.
| Compound Name | 6-amino-4-(3-fluorophenyl)-3-(furan-2-yl)-1-phenyl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile |
|---|---|
| PubChem CID | 19334650 |
| Molecular Formula | C23H15FN4O2 |
| Molecular Weight | 398.40 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | 6-amino-4-(3-fluorophenyl)-3-(furan-2-yl)-1-phenyl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile |
| SMILES | N#CC1=C(N)Oc2c(c(-c3ccco3)nn2-c2ccccc2)C1c1cccc(F)c1 |
| InChI | InChI=1S/C23H15FN4O2/c24-15-7-4-6-14(12-15)19-17(13-25)22(26)30-23-20(19)21(18-10-5-11-29-18)27-28(23)16-8-2-1-3-9-16/h1-12,19H,26H2 |
| InChIKey | FTBWVVXOZJEYBT-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 90.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.40 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dhp_amino_CN_B(9)', 'substructure': 'N/A'} |
|---|