C25H20N4O5 — CID 4775668
6-amino-3-(furan-2-yl)-4-(4-hydroxy-3,5-dimethoxyphenyl)-1-phenyl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile (PubChem CID 4775668) has the molecular formula C25H20N4O5 and a molecular weight of 456.46 g/mol. Its IUPAC name is 6-amino-3-(furan-2-yl)-4-(4-hydroxy-3,5-dimethoxyphenyl)-1-phenyl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile.
| Compound Name | 6-amino-3-(furan-2-yl)-4-(4-hydroxy-3,5-dimethoxyphenyl)-1-phenyl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile |
|---|---|
| PubChem CID | 4775668 |
| Molecular Formula | C25H20N4O5 |
| Molecular Weight | 456.46 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | 6-amino-3-(furan-2-yl)-4-(4-hydroxy-3,5-dimethoxyphenyl)-1-phenyl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile |
| SMILES | COc1cc(C2C(C#N)=C(N)Oc3c2c(-c2ccco2)nn3-c2ccccc2)cc(OC)c1O |
| InChI | InChI=1S/C25H20N4O5/c1-31-18-11-14(12-19(32-2)23(18)30)20-16(13-26)24(27)34-25-21(20)22(17-9-6-10-33-17)28-29(25)15-7-4-3-5-8-15/h3-12,20,30H,27H2,1-2H3 |
| InChIKey | BYAXZBMVZGFLDC-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 128.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.46 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'dhp_amino_CN_B(9)', 'substructure': 'N/A'} |
|---|