C34H34N2O5 — CID 132850213
2-O-benzyl 1-O'-tert-butyl (1S,2R,11bR)-3-methyl-2'-oxospiro[2,6,7,11b-tetrahydrobenzo[a]quinolizine-1,3'-indole]-1',2-dicarboxylate (PubChem CID 132850213) has the molecular formula C34H34N2O5 and a molecular weight of 550.66 g/mol. Its IUPAC name is 2-O-benzyl 1-O'-tert-butyl (1S,2R,11bR)-3-methyl-2'-oxospiro[2,6,7,11b-tetrahydrobenzo[a]quinolizine-1,3'-indole]-1',2-dicarboxylate.
| Compound Name | 2-O-benzyl 1-O'-tert-butyl (1S,2R,11bR)-3-methyl-2'-oxospiro[2,6,7,11b-tetrahydrobenzo[a]quinolizine-1,3'-indole]-1',2-dicarboxylate |
|---|---|
| PubChem CID | 132850213 |
| Molecular Formula | C34H34N2O5 |
| Molecular Weight | 550.66 g/mol |
| Exact Mass | 550.25 |
| IUPAC Name | 2-O-benzyl 1-O'-tert-butyl (1S,2R,11bR)-3-methyl-2'-oxospiro[2,6,7,11b-tetrahydrobenzo[a]quinolizine-1,3'-indole]-1',2-dicarboxylate |
| SMILES | CC1=CN2CCc3ccccc3[C@@H]2[C@]2(C(=O)N(C(=O)OC(C)(C)C)c3ccccc32)[C@@H]1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C34H34N2O5/c1-22-20-35-19-18-24-14-8-9-15-25(24)29(35)34(28(22)30(37)40-21-23-12-6-5-7-13-23)26-16-10-11-17-27(26)36(31(34)38)32(39)41-33(2,3)4/h5-17,20,28-29H,18-19,21H2,1-4H3/t28-,29+,34+/m0/s1 |
| InChIKey | JZRNMVMYLFMFMU-BHZGVWCHSA-N |
| XLogP | 6.08 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.66 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |