C27H32NO- — CID 132850801
4-methyl-2-pyridin-2-yl-6-[2,4,6-tri(propan-2-yl)phenyl]phenolate (PubChem CID 132850801) has the molecular formula C27H32NO- and a molecular weight of 386.56 g/mol. Its IUPAC name is 4-methyl-2-pyridin-2-yl-6-[2,4,6-tri(propan-2-yl)phenyl]phenolate.
| Compound Name | 4-methyl-2-pyridin-2-yl-6-[2,4,6-tri(propan-2-yl)phenyl]phenolate |
|---|---|
| PubChem CID | 132850801 |
| Molecular Formula | C27H32NO- |
| Molecular Weight | 386.56 g/mol |
| Exact Mass | 386.25 |
| IUPAC Name | 4-methyl-2-pyridin-2-yl-6-[2,4,6-tri(propan-2-yl)phenyl]phenolate |
| SMILES | Cc1cc(-c2ccccn2)c([O-])c(-c2c(C(C)C)cc(C(C)C)cc2C(C)C)c1 |
| InChI | InChI=1S/C27H33NO/c1-16(2)20-14-21(17(3)4)26(22(15-20)18(5)6)24-13-19(7)12-23(27(24)29)25-10-8-9-11-28-25/h8-18,29H,1-7H3/p-1 |
| InChIKey | PQZASQAPWCJXRT-UHFFFAOYSA-M |
| XLogP | 7.17 |
| TPSA | 35.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.56 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |