C34H26N2O8 — CID 132917512
ditert-butyl 6,8,17,19-tetraoxo-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(23),2,4,9,11,13,15,20(24),21,25-decaene-7,18-dicarboxylate (PubChem CID 132917512) has the molecular formula C34H26N2O8 and a molecular weight of 590.59 g/mol. Its IUPAC name is ditert-butyl 6,8,17,19-tetraoxo-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(23),2,4,9,11,13,15,20(24),21,25-decaene-7,18-dicarboxylate.
| Compound Name | ditert-butyl 6,8,17,19-tetraoxo-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(23),2,4,9,11,13,15,20(24),21,25-decaene-7,18-dicarboxylate |
|---|---|
| PubChem CID | 132917512 |
| Molecular Formula | C34H26N2O8 |
| Molecular Weight | 590.59 g/mol |
| Exact Mass | 590.17 |
| IUPAC Name | ditert-butyl 6,8,17,19-tetraoxo-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(23),2,4,9,11,13,15,20(24),21,25-decaene-7,18-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)c2ccc3c4ccc5c6c(ccc(c7ccc(c2c37)C1=O)c64)C(=O)N(C(=O)OC(C)(C)C)C5=O |
| InChI | InChI=1S/C34H26N2O8/c1-33(2,3)43-31(41)35-27(37)19-11-7-15-17-9-13-21-26-22(30(40)36(29(21)39)32(42)44-34(4,5)6)14-10-18(24(17)26)16-8-12-20(28(35)38)25(19)23(15)16/h7-14H,1-6H3 |
| InChIKey | HIYLLXNAJRWYPO-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 127.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.59 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|