C16H15NO4 — CID 155208116
tert-butyl 6-hydroxy-2-oxobenzo[cd]indole-1-carboxylate (PubChem CID 155208116) has the molecular formula C16H15NO4 and a molecular weight of 285.30 g/mol. Its IUPAC name is tert-butyl 6-hydroxy-2-oxobenzo[cd]indole-1-carboxylate.
| Compound Name | tert-butyl 6-hydroxy-2-oxobenzo[cd]indole-1-carboxylate |
|---|---|
| PubChem CID | 155208116 |
| Molecular Formula | C16H15NO4 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | tert-butyl 6-hydroxy-2-oxobenzo[cd]indole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)c2cccc3c(O)ccc1c23 |
| InChI | InChI=1S/C16H15NO4/c1-16(2,3)21-15(20)17-11-7-8-12(18)9-5-4-6-10(13(9)11)14(17)19/h4-8,18H,1-3H3 |
| InChIKey | VNJHUCXCMJXYRN-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |