C21H23N3O4 — CID 174971349
tert-butyl 4-(1,3-dioxobenzo[de]isoquinolin-2-yl)piperazine-1-carboxylate (PubChem CID 174971349) has the molecular formula C21H23N3O4 and a molecular weight of 381.43 g/mol. Its IUPAC name is tert-butyl 4-(1,3-dioxobenzo[de]isoquinolin-2-yl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(1,3-dioxobenzo[de]isoquinolin-2-yl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 174971349 |
| Molecular Formula | C21H23N3O4 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | tert-butyl 4-(1,3-dioxobenzo[de]isoquinolin-2-yl)piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(N2C(=O)c3cccc4cccc(c34)C2=O)CC1 |
| InChI | InChI=1S/C21H23N3O4/c1-21(2,3)28-20(27)22-10-12-23(13-11-22)24-18(25)15-8-4-6-14-7-5-9-16(17(14)15)19(24)26/h4-9H,10-13H2,1-3H3 |
| InChIKey | AXFMOPSRWSDXTN-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|