C48H49NO7 — CID 132917814
(2R,3S,4S,5S)-2-[1,2-bis(phenylmethoxy)ethyl]-1-hydroxy-5-(4-methoxy-3-phenylmethoxyphenyl)-3,4-bis(phenylmethoxy)pyrrolidine (PubChem CID 132917814) has the molecular formula C48H49NO7 and a molecular weight of 751.92 g/mol. Its IUPAC name is (2R,3S,4S,5S)-2-[1,2-bis(phenylmethoxy)ethyl]-1-hydroxy-5-(4-methoxy-3-phenylmethoxyphenyl)-3,4-bis(phenylmethoxy)pyrrolidine.
| Compound Name | (2R,3S,4S,5S)-2-[1,2-bis(phenylmethoxy)ethyl]-1-hydroxy-5-(4-methoxy-3-phenylmethoxyphenyl)-3,4-bis(phenylmethoxy)pyrrolidine |
|---|---|
| PubChem CID | 132917814 |
| Molecular Formula | C48H49NO7 |
| Molecular Weight | 751.92 g/mol |
| Exact Mass | 751.35 |
| IUPAC Name | (2R,3S,4S,5S)-2-[1,2-bis(phenylmethoxy)ethyl]-1-hydroxy-5-(4-methoxy-3-phenylmethoxyphenyl)-3,4-bis(phenylmethoxy)pyrrolidine |
| SMILES | COc1ccc([C@H]2[C@H](OCc3ccccc3)[C@@H](OCc3ccccc3)[C@@H](C(COCc3ccccc3)OCc3ccccc3)N2O)cc1OCc1ccccc1 |
| InChI | InChI=1S/C48H49NO7/c1-51-42-28-27-41(29-43(42)53-31-37-19-9-3-10-20-37)45-47(55-33-39-23-13-5-14-24-39)48(56-34-40-25-15-6-16-26-40)46(49(45)50)44(54-32-38-21-11-4-12-22-38)35-52-30-36-17-7-2-8-18-36/h2-29,44-48,50H,30-35H2,1H3/t44?,45-,46+,47-,48-/m0/s1 |
| InChIKey | OBHJMIUAYYAXIO-PIDWKKISSA-N |
| XLogP | 9.36 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.92 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |