C29H30N2O6 — CID 132918066
(13S,16S)-15-tert-butyl-12-[2-(4-methoxyphenyl)acetyl]-5,7-dioxa-12,15-diazapentacyclo[11.7.0.01,16.02,10.04,8]icosa-2,4(8),9,19-tetraene-14,18-dione (PubChem CID 132918066) has the molecular formula C29H30N2O6 and a molecular weight of 502.57 g/mol. Its IUPAC name is (13S,16S)-15-tert-butyl-12-[2-(4-methoxyphenyl)acetyl]-5,7-dioxa-12,15-diazapentacyclo[11.7.0.01,16.02,10.04,8]icosa-2,4(8),9,19-tetraene-14,18-dione.
| Compound Name | (13S,16S)-15-tert-butyl-12-[2-(4-methoxyphenyl)acetyl]-5,7-dioxa-12,15-diazapentacyclo[11.7.0.01,16.02,10.04,8]icosa-2,4(8),9,19-tetraene-14,18-dione |
|---|---|
| PubChem CID | 132918066 |
| Molecular Formula | C29H30N2O6 |
| Molecular Weight | 502.57 g/mol |
| Exact Mass | 502.21 |
| IUPAC Name | (13S,16S)-15-tert-butyl-12-[2-(4-methoxyphenyl)acetyl]-5,7-dioxa-12,15-diazapentacyclo[11.7.0.01,16.02,10.04,8]icosa-2,4(8),9,19-tetraene-14,18-dione |
| SMILES | COc1ccc(CC(=O)N2Cc3cc4c(cc3C35C=CC(=O)C[C@@H]3N(C(C)(C)C)C(=O)[C@@H]25)OCO4)cc1 |
| InChI | InChI=1S/C29H30N2O6/c1-28(2,3)31-24-13-19(32)9-10-29(24)21-14-23-22(36-16-37-23)12-18(21)15-30(26(29)27(31)34)25(33)11-17-5-7-20(35-4)8-6-17/h5-10,12,14,24,26H,11,13,15-16H2,1-4H3/t24-,26+,29?/m0/s1 |
| InChIKey | WLGOSYLTFRJKKE-OFVILPMDSA-N |
| XLogP | 3.15 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.57 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |