C27H32N2O5 — CID 132918072
(13S,16S)-15-cyclohexyl-12-pentanoyl-5,7-dioxa-12,15-diazapentacyclo[11.7.0.01,16.02,10.04,8]icosa-2,4(8),9,19-tetraene-14,18-dione (PubChem CID 132918072) has the molecular formula C27H32N2O5 and a molecular weight of 464.56 g/mol. Its IUPAC name is (13S,16S)-15-cyclohexyl-12-pentanoyl-5,7-dioxa-12,15-diazapentacyclo[11.7.0.01,16.02,10.04,8]icosa-2,4(8),9,19-tetraene-14,18-dione.
| Compound Name | (13S,16S)-15-cyclohexyl-12-pentanoyl-5,7-dioxa-12,15-diazapentacyclo[11.7.0.01,16.02,10.04,8]icosa-2,4(8),9,19-tetraene-14,18-dione |
|---|---|
| PubChem CID | 132918072 |
| Molecular Formula | C27H32N2O5 |
| Molecular Weight | 464.56 g/mol |
| Exact Mass | 464.23 |
| IUPAC Name | (13S,16S)-15-cyclohexyl-12-pentanoyl-5,7-dioxa-12,15-diazapentacyclo[11.7.0.01,16.02,10.04,8]icosa-2,4(8),9,19-tetraene-14,18-dione |
| SMILES | CCCCC(=O)N1Cc2cc3c(cc2C24C=CC(=O)C[C@@H]2N(C2CCCCC2)C(=O)[C@@H]14)OCO3 |
| InChI | InChI=1S/C27H32N2O5/c1-2-3-9-24(31)28-15-17-12-21-22(34-16-33-21)14-20(17)27-11-10-19(30)13-23(27)29(26(32)25(27)28)18-7-5-4-6-8-18/h10-12,14,18,23,25H,2-9,13,15-16H2,1H3/t23-,25+,27?/m0/s1 |
| InChIKey | UJAIESZFOKNIHH-UAXORVEISA-N |
| XLogP | 3.63 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.56 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |