C22H34N2O — CID 132918179
(1R,2S,5S,9R,12S,13R,16S)-6,13-dimethyl-16-(methylamino)-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-18-en-8-one (PubChem CID 132918179) has the molecular formula C22H34N2O and a molecular weight of 342.53 g/mol. Its IUPAC name is (1R,2S,5S,9R,12S,13R,16S)-6,13-dimethyl-16-(methylamino)-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-18-en-8-one.
| Compound Name | (1R,2S,5S,9R,12S,13R,16S)-6,13-dimethyl-16-(methylamino)-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-18-en-8-one |
|---|---|
| PubChem CID | 132918179 |
| Molecular Formula | C22H34N2O |
| Molecular Weight | 342.53 g/mol |
| Exact Mass | 342.27 |
| IUPAC Name | (1R,2S,5S,9R,12S,13R,16S)-6,13-dimethyl-16-(methylamino)-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-18-en-8-one |
| SMILES | CN[C@H]1CC[C@@]2(C)C(=CC[C@H]3[C@@H]4CC[C@@H]5C(C)NC(=O)[C@@]54CC[C@@H]32)C1 |
| InChI | InChI=1S/C22H34N2O/c1-13-17-6-7-19-16-5-4-14-12-15(23-3)8-10-21(14,2)18(16)9-11-22(17,19)20(25)24-13/h4,13,15-19,23H,5-12H2,1-3H3,(H,24,25)/t13?,15-,16+,17+,18-,19-,21-,22-/m0/s1 |
| InChIKey | DVFNLHMIYCDEMD-NVBNDIDUSA-N |
| XLogP | 3.65 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.53 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|