C24H38N2O — CID 162957405
N-[(1R,2S,5S,6S,9R,12S,13R,16S)-6,7,13-trimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-18-en-16-yl]acetamide (PubChem CID 162957405) has the molecular formula C24H38N2O and a molecular weight of 370.58 g/mol. Its IUPAC name is N-[(1R,2S,5S,6S,9R,12S,13R,16S)-6,7,13-trimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-18-en-16-yl]acetamide.
| Compound Name | N-[(1R,2S,5S,6S,9R,12S,13R,16S)-6,7,13-trimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-18-en-16-yl]acetamide |
|---|---|
| PubChem CID | 162957405 |
| Molecular Formula | C24H38N2O |
| Molecular Weight | 370.58 g/mol |
| Exact Mass | 370.30 |
| IUPAC Name | N-[(1R,2S,5S,6S,9R,12S,13R,16S)-6,7,13-trimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-18-en-16-yl]acetamide |
| SMILES | CC(=O)N[C@H]1CC[C@@]2(C)C(=CC[C@H]3[C@@H]4CC[C@@H]5[C@H](C)N(C)C[C@@]54CC[C@@H]32)C1 |
| InChI | InChI=1S/C24H38N2O/c1-15-20-7-8-22-19-6-5-17-13-18(25-16(2)27)9-11-23(17,3)21(19)10-12-24(20,22)14-26(15)4/h5,15,18-22H,6-14H2,1-4H3,(H,25,27)/t15-,18-,19+,20+,21-,22-,23-,24-/m0/s1 |
| InChIKey | GLIWUZBUVUGCTJ-DKJLUOPISA-N |
| XLogP | 4.38 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.58 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|