C32H46N2O — CID 71121280
(2R)-N-methyl-2-phenyl-N-[(1R,2S,5S,6S,9R,12S,13R,16S)-6,7,13-trimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-18-en-16-yl]propanamide (PubChem CID 71121280) has the molecular formula C32H46N2O and a molecular weight of 474.73 g/mol. Its IUPAC name is (2R)-N-methyl-2-phenyl-N-[(1R,2S,5S,6S,9R,12S,13R,16S)-6,7,13-trimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-18-en-16-yl]propanamide.
| Compound Name | (2R)-N-methyl-2-phenyl-N-[(1R,2S,5S,6S,9R,12S,13R,16S)-6,7,13-trimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-18-en-16-yl]propanamide |
|---|---|
| PubChem CID | 71121280 |
| Molecular Formula | C32H46N2O |
| Molecular Weight | 474.73 g/mol |
| Exact Mass | 474.36 |
| IUPAC Name | (2R)-N-methyl-2-phenyl-N-[(1R,2S,5S,6S,9R,12S,13R,16S)-6,7,13-trimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-18-en-16-yl]propanamide |
| SMILES | C[C@@H](C(=O)N(C)[C@H]1CC[C@@]2(C)C(=CC[C@H]3[C@@H]4CC[C@@H]5[C@H](C)N(C)C[C@@]54CC[C@@H]32)C1)c1ccccc1 |
| InChI | InChI=1S/C32H46N2O/c1-21(23-9-7-6-8-10-23)30(35)34(5)25-15-17-31(3)24(19-25)11-12-26-28(31)16-18-32-20-33(4)22(2)27(32)13-14-29(26)32/h6-11,21-22,25-29H,12-20H2,1-5H3/t21-,22+,25+,26-,27-,28+,29+,31+,32+/m1/s1 |
| InChIKey | IKAJYXXSMQHIII-HFXYWCAPSA-N |
| XLogP | 6.51 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.73 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|