C32H47N3O — CID 11496839
(2R)-2-amino-N-methyl-3-phenyl-N-[(1R,2S,5S,6S,9R,13R,16S)-6,7,13-trimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-18-en-16-yl]propanamide (PubChem CID 11496839) has the molecular formula C32H47N3O and a molecular weight of 489.75 g/mol. Its IUPAC name is (2R)-2-amino-N-methyl-3-phenyl-N-[(1R,2S,5S,6S,9R,13R,16S)-6,7,13-trimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-18-en-16-yl]propanamide.
| Compound Name | (2R)-2-amino-N-methyl-3-phenyl-N-[(1R,2S,5S,6S,9R,13R,16S)-6,7,13-trimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-18-en-16-yl]propanamide |
|---|---|
| PubChem CID | 11496839 |
| Molecular Formula | C32H47N3O |
| Molecular Weight | 489.75 g/mol |
| Exact Mass | 489.37 |
| IUPAC Name | (2R)-2-amino-N-methyl-3-phenyl-N-[(1R,2S,5S,6S,9R,13R,16S)-6,7,13-trimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-18-en-16-yl]propanamide |
| SMILES | C[C@H]1[C@H]2CC[C@H]3[C@@H]4CC=C5C[C@@H](N(C)C(=O)[C@H](N)Cc6ccccc6)CC[C@]5(C)C4CC[C@]23CN1C |
| InChI | InChI=1S/C32H47N3O/c1-21-26-12-13-28-25-11-10-23-19-24(35(4)30(36)29(33)18-22-8-6-5-7-9-22)14-16-31(23,2)27(25)15-17-32(26,28)20-34(21)3/h5-10,21,24-29H,11-20,33H2,1-4H3/t21-,24-,25+,26+,27?,28-,29+,31-,32-/m0/s1 |
| InChIKey | LPARPGAQDLJMEN-CAQKRJHLSA-N |
| XLogP | 5.28 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.75 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|