C27H44N2O3 — CID 59678794
3-hydroxypropyl N-methyl-N-[(1R,2S,5S,6S,12S,13R,16S)-6,7,13-trimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-18-en-16-yl]carbamate (PubChem CID 59678794) has the molecular formula C27H44N2O3 and a molecular weight of 444.66 g/mol. Its IUPAC name is 3-hydroxypropyl N-methyl-N-[(1R,2S,5S,6S,12S,13R,16S)-6,7,13-trimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-18-en-16-yl]carbamate.
| Compound Name | 3-hydroxypropyl N-methyl-N-[(1R,2S,5S,6S,12S,13R,16S)-6,7,13-trimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-18-en-16-yl]carbamate |
|---|---|
| PubChem CID | 59678794 |
| Molecular Formula | C27H44N2O3 |
| Molecular Weight | 444.66 g/mol |
| Exact Mass | 444.34 |
| IUPAC Name | 3-hydroxypropyl N-methyl-N-[(1R,2S,5S,6S,12S,13R,16S)-6,7,13-trimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-18-en-16-yl]carbamate |
| SMILES | C[C@H]1[C@H]2CC[C@H]3[C@@H]4CC=C5C[C@@H](N(C)C(=O)OCCCO)CC[C@]5(C)[C@H]4CCC23CN1C |
| InChI | InChI=1S/C27H44N2O3/c1-18-22-8-9-24-21-7-6-19-16-20(29(4)25(31)32-15-5-14-30)10-12-26(19,2)23(21)11-13-27(22,24)17-28(18)3/h6,18,20-24,30H,5,7-17H2,1-4H3/t18-,20-,21+,22+,23-,24-,26-,27?/m0/s1 |
| InChIKey | YTPHNGNFUMQLNM-ZLVKKNNUSA-N |
| XLogP | 4.70 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.66 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|