C24H40N2 — CID 162847174
(1S,2R,5S,6S,9R,12R,13S,16R)-N,N,6,7,13-pentamethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-18-en-16-amine (PubChem CID 162847174) has the molecular formula C24H40N2 and a molecular weight of 356.60 g/mol. Its IUPAC name is (1S,2R,5S,6S,9R,12R,13S,16R)-N,N,6,7,13-pentamethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-18-en-16-amine.
| Compound Name | (1S,2R,5S,6S,9R,12R,13S,16R)-N,N,6,7,13-pentamethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-18-en-16-amine |
|---|---|
| PubChem CID | 162847174 |
| Molecular Formula | C24H40N2 |
| Molecular Weight | 356.60 g/mol |
| Exact Mass | 356.32 |
| IUPAC Name | (1S,2R,5S,6S,9R,12R,13S,16R)-N,N,6,7,13-pentamethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-18-en-16-amine |
| SMILES | C[C@H]1[C@H]2CC[C@@H]3[C@H]4CC=C5C[C@H](N(C)C)CC[C@@]5(C)[C@@H]4CC[C@@]32CN1C |
| InChI | InChI=1S/C24H40N2/c1-16-20-8-9-22-19-7-6-17-14-18(25(3)4)10-12-23(17,2)21(19)11-13-24(20,22)15-26(16)5/h6,16,18-22H,7-15H2,1-5H3/t16-,18+,19-,20+,21+,22+,23+,24-/m0/s1 |
| InChIKey | GPLGAQQQNWMVMM-SMKBVADZSA-N |
| XLogP | 4.81 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.60 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|