C29H51N3OS — CID 11562229
(1S)-N,3-dimethyl-1-(methylamino)-N-[(1R,2S,5S,6S,9R,13R,16S)-6,7,13-trimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-18-en-16-yl]butane-1-sulfinamide (PubChem CID 11562229) has the molecular formula C29H51N3OS and a molecular weight of 489.81 g/mol. Its IUPAC name is (1S)-N,3-dimethyl-1-(methylamino)-N-[(1R,2S,5S,6S,9R,13R,16S)-6,7,13-trimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-18-en-16-yl]butane-1-sulfinamide.
| Compound Name | (1S)-N,3-dimethyl-1-(methylamino)-N-[(1R,2S,5S,6S,9R,13R,16S)-6,7,13-trimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-18-en-16-yl]butane-1-sulfinamide |
|---|---|
| PubChem CID | 11562229 |
| Molecular Formula | C29H51N3OS |
| Molecular Weight | 489.81 g/mol |
| Exact Mass | 489.38 |
| IUPAC Name | (1S)-N,3-dimethyl-1-(methylamino)-N-[(1R,2S,5S,6S,9R,13R,16S)-6,7,13-trimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-18-en-16-yl]butane-1-sulfinamide |
| SMILES | CN[C@H](CC(C)C)S(=O)N(C)[C@H]1CC[C@@]2(C)C(=CC[C@@H]3C2CC[C@]24CN(C)[C@@H](C)[C@H]2CC[C@@H]34)C1 |
| InChI | InChI=1S/C29H51N3OS/c1-19(2)16-27(30-5)34(33)32(7)22-12-14-28(4)21(17-22)8-9-23-25(28)13-15-29-18-31(6)20(3)24(29)10-11-26(23)29/h8,19-20,22-27,30H,9-18H2,1-7H3/t20-,22-,23+,24+,25?,26-,27-,28-,29-,34?/m0/s1 |
| InChIKey | VSOJIINLCDWRCS-LONNGYHLSA-N |
| XLogP | 5.44 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.81 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|