C27H42N4O — CID 67423913
2-amino-3-cyano-N-methyl-N-(6,7,13-trimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-18-en-16-yl)propanamide (PubChem CID 67423913) has the molecular formula C27H42N4O and a molecular weight of 438.66 g/mol. Its IUPAC name is 2-amino-3-cyano-N-methyl-N-(6,7,13-trimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-18-en-16-yl)propanamide.
| Compound Name | 2-amino-3-cyano-N-methyl-N-(6,7,13-trimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-18-en-16-yl)propanamide |
|---|---|
| PubChem CID | 67423913 |
| Molecular Formula | C27H42N4O |
| Molecular Weight | 438.66 g/mol |
| Exact Mass | 438.34 |
| IUPAC Name | 2-amino-3-cyano-N-methyl-N-(6,7,13-trimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-18-en-16-yl)propanamide |
| SMILES | CC1C2CCC3C4CC=C5CC(N(C)C(=O)C(N)CC#N)CCC5(C)C4CCC32CN1C |
| InChI | InChI=1S/C27H42N4O/c1-17-21-7-8-23-20-6-5-18-15-19(31(4)25(32)24(29)11-14-28)9-12-26(18,2)22(20)10-13-27(21,23)16-30(17)3/h5,17,19-24H,6-13,15-16,29H2,1-4H3 |
| InChIKey | RKYDKKPKYJIHHB-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 73.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.66 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|