C34H48N2O3 — CID 11562822
[(2S)-1-[methyl-[(1R,2S,5S,6S,9R,13R,16S)-6,7,13-trimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-18-en-16-yl]amino]-1-oxo-3-phenylpropan-2-yl] acetate (PubChem CID 11562822) has the molecular formula C34H48N2O3 and a molecular weight of 532.77 g/mol. Its IUPAC name is [(2S)-1-[methyl-[(1R,2S,5S,6S,9R,13R,16S)-6,7,13-trimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-18-en-16-yl]amino]-1-oxo-3-phenylpropan-2-yl] acetate.
| Compound Name | [(2S)-1-[methyl-[(1R,2S,5S,6S,9R,13R,16S)-6,7,13-trimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-18-en-16-yl]amino]-1-oxo-3-phenylpropan-2-yl] acetate |
|---|---|
| PubChem CID | 11562822 |
| Molecular Formula | C34H48N2O3 |
| Molecular Weight | 532.77 g/mol |
| Exact Mass | 532.37 |
| IUPAC Name | [(2S)-1-[methyl-[(1R,2S,5S,6S,9R,13R,16S)-6,7,13-trimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-18-en-16-yl]amino]-1-oxo-3-phenylpropan-2-yl] acetate |
| SMILES | CC(=O)O[C@@H](Cc1ccccc1)C(=O)N(C)[C@H]1CC[C@@]2(C)C(=CC[C@@H]3C2CC[C@]24CN(C)[C@@H](C)[C@H]2CC[C@@H]34)C1 |
| InChI | InChI=1S/C34H48N2O3/c1-22-28-13-14-30-27-12-11-25-20-26(15-17-33(25,3)29(27)16-18-34(28,30)21-35(22)4)36(5)32(38)31(39-23(2)37)19-24-9-7-6-8-10-24/h6-11,22,26-31H,12-21H2,1-5H3/t22-,26-,27+,28+,29?,30-,31-,33-,34-/m0/s1 |
| InChIKey | ATMKAZVKOSRAGN-BFSOWSDHSA-N |
| XLogP | 5.88 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.77 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|