C27H39N3O2 — CID 11510429
N-methyl-N-[(1R,2S,5S,6S,9R,13R,16S)-6,7,13-trimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-18-en-16-yl]-1,2-oxazole-5-carboxamide (PubChem CID 11510429) has the molecular formula C27H39N3O2 and a molecular weight of 437.63 g/mol. Its IUPAC name is N-methyl-N-[(1R,2S,5S,6S,9R,13R,16S)-6,7,13-trimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-18-en-16-yl]-1,2-oxazole-5-carboxamide.
| Compound Name | N-methyl-N-[(1R,2S,5S,6S,9R,13R,16S)-6,7,13-trimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-18-en-16-yl]-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 11510429 |
| Molecular Formula | C27H39N3O2 |
| Molecular Weight | 437.63 g/mol |
| Exact Mass | 437.30 |
| IUPAC Name | N-methyl-N-[(1R,2S,5S,6S,9R,13R,16S)-6,7,13-trimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-18-en-16-yl]-1,2-oxazole-5-carboxamide |
| SMILES | C[C@H]1[C@H]2CC[C@H]3[C@@H]4CC=C5C[C@@H](N(C)C(=O)c6ccno6)CC[C@]5(C)C4CC[C@]23CN1C |
| InChI | InChI=1S/C27H39N3O2/c1-17-21-7-8-23-20-6-5-18-15-19(30(4)25(31)24-11-14-28-32-24)9-12-26(18,2)22(20)10-13-27(21,23)16-29(17)3/h5,11,14,17,19-23H,6-10,12-13,15-16H2,1-4H3/t17-,19-,20+,21+,22?,23-,26-,27-/m0/s1 |
| InChIKey | FWUAICOHVQFBRU-CTTYWFELSA-N |
| XLogP | 5.01 |
| TPSA | 49.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.63 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|